C19H26N2O3 — CID 11012950
(3S,4R)-3-benzyl-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]oxan-2-one (PubChem CID 11012950) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3S,4R)-3-benzyl-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]oxan-2-one.
| Compound Name | (3S,4R)-3-benzyl-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]oxan-2-one |
|---|---|
| PubChem CID | 11012950 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3S,4R)-3-benzyl-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]oxan-2-one |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@@H]1CCOC(=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2O3/c1-23-14-17-8-5-10-21(17)20-13-16-9-11-24-19(22)18(16)12-15-6-3-2-4-7-15/h2-4,6-7,13,16-18H,5,8-12,14H2,1H3/b20-13+/t16-,17-,18-/m0/s1 |
| InChIKey | RCGLAHHXXFZEDA-RQLMIGPGSA-N |
| XLogP | 2.51 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|