C21H27F3N2O5 — CID 102379476
dimethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate (PubChem CID 102379476) has the molecular formula C21H27F3N2O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is dimethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate.
| Compound Name | dimethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate |
|---|---|
| PubChem CID | 102379476 |
| Molecular Formula | C21H27F3N2O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | dimethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate |
| SMILES | COC[C@@H]1CCCN1/N=C(\C[C@@H](c1ccccc1)C(C(=O)OC)C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C21H27F3N2O5/c1-29-13-15-10-7-11-26(15)25-17(21(22,23)24)12-16(14-8-5-4-6-9-14)18(19(27)30-2)20(28)31-3/h4-6,8-9,15-16,18H,7,10-13H2,1-3H3/b25-17+/t15-,16-/m0/s1 |
| InChIKey | PYRZVWZRLJTBKR-QPBNAJQBSA-N |
| XLogP | 3.15 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|