C22H32N2O4 — CID 10949120
methyl (3R)-3-[(2E,3S)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminooxepan-3-yl]-3-phenylpropanoate (PubChem CID 10949120) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is methyl (3R)-3-[(2E,3S)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminooxepan-3-yl]-3-phenylpropanoate.
| Compound Name | methyl (3R)-3-[(2E,3S)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminooxepan-3-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10949120 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | methyl (3R)-3-[(2E,3S)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminooxepan-3-yl]-3-phenylpropanoate |
| SMILES | COC[C@@H]1CCCN1/N=C1/OCCCC[C@H]1[C@@H](CC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O4/c1-26-16-18-11-8-13-24(18)23-22-19(12-6-7-14-28-22)20(15-21(25)27-2)17-9-4-3-5-10-17/h3-5,9-10,18-20H,6-8,11-16H2,1-2H3/b23-22+/t18-,19-,20-/m0/s1 |
| InChIKey | NWHOZNVZKHZOKW-UPMKSEMOSA-N |
| XLogP | 3.57 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|