C24H36N2O3 — CID 11014869
(3E,4S,5R)-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-5-(2-methylpropyl)-4-phenyloxolan-2-one (PubChem CID 11014869) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is (3E,4S,5R)-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-5-(2-methylpropyl)-4-phenyloxolan-2-one.
| Compound Name | (3E,4S,5R)-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-5-(2-methylpropyl)-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 11014869 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | (3E,4S,5R)-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-5-(2-methylpropyl)-4-phenyloxolan-2-one |
| SMILES | CCC(CC)(OC)[C@@H]1CCCN1/N=C1/C(=O)O[C@H](CC(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H36N2O3/c1-6-24(7-2,28-5)20-14-11-15-26(20)25-22-21(18-12-9-8-10-13-18)19(16-17(3)4)29-23(22)27/h8-10,12-13,17,19-21H,6-7,11,14-16H2,1-5H3/b25-22+/t19-,20+,21-/m1/s1 |
| InChIKey | UTSWLIASBVGUDW-NNIFEURMSA-N |
| XLogP | 4.77 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|