C23H31F3N2O5 — CID 11476985
diethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate (PubChem CID 11476985) has the molecular formula C23H31F3N2O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is diethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate.
| Compound Name | diethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate |
|---|---|
| PubChem CID | 11476985 |
| Molecular Formula | C23H31F3N2O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | diethyl 2-[(1R,3E)-4,4,4-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylbutyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](C/C(=N\N1CCC[C@H]1COC)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C23H31F3N2O5/c1-4-32-21(29)20(22(30)33-5-2)18(16-10-7-6-8-11-16)14-19(23(24,25)26)27-28-13-9-12-17(28)15-31-3/h6-8,10-11,17-18,20H,4-5,9,12-15H2,1-3H3/b27-19+/t17-,18-/m0/s1 |
| InChIKey | CUODNKMIAKFNKW-LXNJAMRLSA-N |
| XLogP | 3.93 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|