C21H32N2O3 — CID 134877007
methyl (4R,5S,6E)-4-benzyl-6-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-5-methylhexanoate (PubChem CID 134877007) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is methyl (4R,5S,6E)-4-benzyl-6-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-5-methylhexanoate.
| Compound Name | methyl (4R,5S,6E)-4-benzyl-6-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-5-methylhexanoate |
|---|---|
| PubChem CID | 134877007 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | methyl (4R,5S,6E)-4-benzyl-6-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-5-methylhexanoate |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@@H](C)[C@H](CCC(=O)OC)Cc1ccccc1 |
| InChI | InChI=1S/C21H32N2O3/c1-17(15-22-23-13-7-10-20(23)16-25-2)19(11-12-21(24)26-3)14-18-8-5-4-6-9-18/h4-6,8-9,15,17,19-20H,7,10-14,16H2,1-3H3/b22-15+/t17-,19-,20+/m1/s1 |
| InChIKey | DLWVAZQPWXUGJT-WRPJBAGHSA-N |
| XLogP | 3.53 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|