C22H26N2O2 — CID 11035503
(3R,4E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,3-diphenylbutan-1-one (PubChem CID 11035503) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3R,4E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,3-diphenylbutan-1-one.
| Compound Name | (3R,4E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,3-diphenylbutan-1-one |
|---|---|
| PubChem CID | 11035503 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (3R,4E)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,3-diphenylbutan-1-one |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c1-26-17-21-13-8-14-24(21)23-16-20(18-9-4-2-5-10-18)15-22(25)19-11-6-3-7-12-19/h2-7,9-12,16,20-21H,8,13-15,17H2,1H3/b23-16+/t20-,21-/m0/s1 |
| InChIKey | KZIXHLDDZMMZFI-NPKALDHYSA-N |
| XLogP | 4.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|