C30H44N2O2Si — CID 10962034
(E,E,2R)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-diphenylbut-3-en-1-imine (PubChem CID 10962034) has the molecular formula C30H44N2O2Si and a molecular weight of 492.78 g/mol. Its IUPAC name is (E,E,2R)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-diphenylbut-3-en-1-imine.
| Compound Name | (E,E,2R)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-diphenylbut-3-en-1-imine |
|---|---|
| PubChem CID | 10962034 |
| Molecular Formula | C30H44N2O2Si |
| Molecular Weight | 492.78 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | (E,E,2R)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-diphenylbut-3-en-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](/C=C(/O[Si](C)(C)C(C)(C)C(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H44N2O2Si/c1-24(2)30(3,4)35(6,7)34-29(26-17-12-9-13-18-26)21-27(25-15-10-8-11-16-25)22-31-32-20-14-19-28(32)23-33-5/h8-13,15-18,21-22,24,27-28H,14,19-20,23H2,1-7H3/b29-21+,31-22+/t27-,28-/m0/s1 |
| InChIKey | KSZCNIPOYSQWOT-NTOGAEAXSA-N |
| XLogP | 7.57 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|