C25H34NO3Si+ — CID 134843770
[[(2S)-1-(3,3-dimethoxyprop-2-enylidene)pyrrolidin-1-ium-2-yl]-diphenylmethoxy]-trimethylsilane (PubChem CID 134843770) has the molecular formula C25H34NO3Si+ and a molecular weight of 424.64 g/mol. Its IUPAC name is [[(2S)-1-(3,3-dimethoxyprop-2-enylidene)pyrrolidin-1-ium-2-yl]-diphenylmethoxy]-trimethylsilane.
| Compound Name | [[(2S)-1-(3,3-dimethoxyprop-2-enylidene)pyrrolidin-1-ium-2-yl]-diphenylmethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 134843770 |
| Molecular Formula | C25H34NO3Si+ |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [[(2S)-1-(3,3-dimethoxyprop-2-enylidene)pyrrolidin-1-ium-2-yl]-diphenylmethoxy]-trimethylsilane |
| SMILES | COC(=C/C=[N+]1\CCC[C@H]1C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C25H34NO3Si/c1-27-24(28-2)18-20-26-19-12-17-23(26)25(29-30(3,4)5,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-11,13-16,18,20,23H,12,17,19H2,1-5H3/q+1/b26-20+/t23-/m0/s1 |
| InChIKey | JLUOAVKCUIBYPI-XCQFTPQJSA-N |
| XLogP | 5.16 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|