C26H38NO2Si+ — CID 53310570
1-[2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]-2-methylpentan-3-ol (PubChem CID 53310570) has the molecular formula C26H38NO2Si+ and a molecular weight of 424.68 g/mol. Its IUPAC name is 1-[2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]-2-methylpentan-3-ol.
| Compound Name | 1-[2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 53310570 |
| Molecular Formula | C26H38NO2Si+ |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 1-[2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]-2-methylpentan-3-ol |
| SMILES | CCC(O)C(C)/C=[N+]1\CCCC1C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H38NO2Si/c1-6-24(28)21(2)20-27-19-13-18-25(27)26(29-30(3,4)5,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17,20-21,24-25,28H,6,13,18-19H2,1-5H3/q+1/b27-20+ |
| InChIKey | HVBHRBCLEIWXMK-NHFJDJAPSA-N |
| XLogP | 5.43 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|