C30H37NO2Si — CID 134848170
(E,1R)-4-[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-1-phenylbut-3-en-1-ol (PubChem CID 134848170) has the molecular formula C30H37NO2Si and a molecular weight of 471.72 g/mol. Its IUPAC name is (E,1R)-4-[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-1-phenylbut-3-en-1-ol.
| Compound Name | (E,1R)-4-[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 134848170 |
| Molecular Formula | C30H37NO2Si |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | (E,1R)-4-[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-1-phenylbut-3-en-1-ol |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1/C=C/C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C30H37NO2Si/c1-34(2,3)33-30(26-17-9-5-10-18-26,27-19-11-6-12-20-27)29-22-14-24-31(29)23-13-21-28(32)25-15-7-4-8-16-25/h4-13,15-20,23,28-29,32H,14,21-22,24H2,1-3H3/b23-13+/t28-,29+/m1/s1 |
| InChIKey | PQECCKQWBKXPBL-UROJGUBQSA-N |
| XLogP | 6.88 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|