C29H37NO — CID 14792574
(1S,2R)-2-[bis(4-phenylbutyl)amino]-1-phenylpropan-1-ol (PubChem CID 14792574) has the molecular formula C29H37NO and a molecular weight of 415.62 g/mol. Its IUPAC name is (1S,2R)-2-[bis(4-phenylbutyl)amino]-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-2-[bis(4-phenylbutyl)amino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 14792574 |
| Molecular Formula | C29H37NO |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (1S,2R)-2-[bis(4-phenylbutyl)amino]-1-phenylpropan-1-ol |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(CCCCc1ccccc1)CCCCc1ccccc1 |
| InChI | InChI=1S/C29H37NO/c1-25(29(31)28-21-9-4-10-22-28)30(23-13-11-19-26-15-5-2-6-16-26)24-14-12-20-27-17-7-3-8-18-27/h2-10,15-18,21-22,25,29,31H,11-14,19-20,23-24H2,1H3/t25-,29-/m1/s1 |
| InChIKey | RKJMHOOVDGYHBZ-VAVYLYDRSA-N |
| XLogP | 6.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|