C31H39N2O3Si+ — CID 134838759
trimethyl-[[(2S)-1-[(2R,3S)-2-methyl-4-nitro-3-phenylbutylidene]pyrrolidin-1-ium-2-yl]-diphenylmethoxy]silane (PubChem CID 134838759) has the molecular formula C31H39N2O3Si+ and a molecular weight of 515.75 g/mol. Its IUPAC name is trimethyl-[[(2S)-1-[(2R,3S)-2-methyl-4-nitro-3-phenylbutylidene]pyrrolidin-1-ium-2-yl]-diphenylmethoxy]silane.
| Compound Name | trimethyl-[[(2S)-1-[(2R,3S)-2-methyl-4-nitro-3-phenylbutylidene]pyrrolidin-1-ium-2-yl]-diphenylmethoxy]silane |
|---|---|
| PubChem CID | 134838759 |
| Molecular Formula | C31H39N2O3Si+ |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | trimethyl-[[(2S)-1-[(2R,3S)-2-methyl-4-nitro-3-phenylbutylidene]pyrrolidin-1-ium-2-yl]-diphenylmethoxy]silane |
| SMILES | C[C@@H](/C=[N+]1\CCC[C@H]1C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C31H39N2O3Si/c1-25(29(24-33(34)35)26-15-8-5-9-16-26)23-32-22-14-21-30(32)31(36-37(2,3)4,27-17-10-6-11-18-27)28-19-12-7-13-20-28/h5-13,15-20,23,25,29-30H,14,21-22,24H2,1-4H3/q+1/b32-23+/t25-,29-,30-/m0/s1 |
| InChIKey | JKMZBGSEBLRPLS-JDKMDMBYSA-N |
| XLogP | 6.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|