C31H38N2O3Si — CID 134838471
trimethyl-[[(2S)-1-[(2R,3S,4S)-2-methyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]silane (PubChem CID 134838471) has the molecular formula C31H38N2O3Si and a molecular weight of 514.74 g/mol. Its IUPAC name is trimethyl-[[(2S)-1-[(2R,3S,4S)-2-methyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]silane.
| Compound Name | trimethyl-[[(2S)-1-[(2R,3S,4S)-2-methyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]silane |
|---|---|
| PubChem CID | 134838471 |
| Molecular Formula | C31H38N2O3Si |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | trimethyl-[[(2S)-1-[(2R,3S,4S)-2-methyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]silane |
| SMILES | C[C@H]1C(N2CCC[C@H]2C(O[Si](C)(C)C)(c2ccccc2)c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C31H38N2O3Si/c1-23-28(24-15-8-5-9-16-24)30(33(34)35)29(23)32-22-14-21-27(32)31(36-37(2,3)4,25-17-10-6-11-18-25)26-19-12-7-13-20-26/h5-13,15-20,23,27-30H,14,21-22H2,1-4H3/t23-,27+,28+,29?,30+/m1/s1 |
| InChIKey | KRSFUFGDVMUVHG-QPWGRPHKSA-N |
| XLogP | 6.69 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|