C32H40N2O3Si — CID 134838677
[[(2S)-1-[(3R,4S)-2,2-dimethyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane (PubChem CID 134838677) has the molecular formula C32H40N2O3Si and a molecular weight of 528.77 g/mol. Its IUPAC name is [[(2S)-1-[(3R,4S)-2,2-dimethyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane.
| Compound Name | [[(2S)-1-[(3R,4S)-2,2-dimethyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 134838677 |
| Molecular Formula | C32H40N2O3Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | [[(2S)-1-[(3R,4S)-2,2-dimethyl-4-nitro-3-phenylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane |
| SMILES | CC1(C)C(N2CCC[C@H]2C(O[Si](C)(C)C)(c2ccccc2)c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H40N2O3Si/c1-31(2)28(24-16-9-6-10-17-24)29(34(35)36)30(31)33-23-15-22-27(33)32(37-38(3,4)5,25-18-11-7-12-19-25)26-20-13-8-14-21-26/h6-14,16-21,27-30H,15,22-23H2,1-5H3/t27-,28-,29-,30?/m0/s1 |
| InChIKey | JAVPHQRGZJHXCG-UNVCSADESA-N |
| XLogP | 7.08 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|