C31H46N2O3Si — CID 135004294
[[(2S)-1-[(2S,3S,4R)-3-tert-butyl-2-nitro-4-propan-2-ylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane (PubChem CID 135004294) has the molecular formula C31H46N2O3Si and a molecular weight of 522.81 g/mol. Its IUPAC name is [[(2S)-1-[(2S,3S,4R)-3-tert-butyl-2-nitro-4-propan-2-ylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane.
| Compound Name | [[(2S)-1-[(2S,3S,4R)-3-tert-butyl-2-nitro-4-propan-2-ylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 135004294 |
| Molecular Formula | C31H46N2O3Si |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | [[(2S)-1-[(2S,3S,4R)-3-tert-butyl-2-nitro-4-propan-2-ylcyclobutyl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane |
| SMILES | CC(C)[C@H]1C(N2CCC[C@H]2C(O[Si](C)(C)C)(c2ccccc2)c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C31H46N2O3Si/c1-22(2)26-27(30(3,4)5)29(33(34)35)28(26)32-21-15-20-25(32)31(36-37(6,7)8,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-14,16-19,22,25-29H,15,20-21H2,1-8H3/t25-,26+,27+,28?,29-/m0/s1 |
| InChIKey | SEZQGWLSIMLWEM-NNDMGNLASA-N |
| XLogP | 7.21 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|