C39H38NOSi+ — CID 102026756
[diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-methyl-diphenylsilane (PubChem CID 102026756) has the molecular formula C39H38NOSi+ and a molecular weight of 564.83 g/mol. Its IUPAC name is [diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-methyl-diphenylsilane.
| Compound Name | [diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 102026756 |
| Molecular Formula | C39H38NOSi+ |
| Molecular Weight | 564.83 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-methyl-diphenylsilane |
| SMILES | C[Si](OC(c1ccccc1)(c1ccccc1)[C@@H]1CCC/[N+]1=C\C=C\c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H38NOSi/c1-42(36-26-13-5-14-27-36,37-28-15-6-16-29-37)41-39(34-22-9-3-10-23-34,35-24-11-4-12-25-35)38-30-18-32-40(38)31-17-21-33-19-7-2-8-20-33/h2-17,19-29,31,38H,18,30,32H2,1H3/q+1/b21-17+,40-31+/t38-/m0/s1 |
| InChIKey | QYWYSZPEZXHMMH-QEDCYSRLSA-N |
| XLogP | 7.30 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.83 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|