C45H57N2O3Si+ — CID 154707642
tert-butyl (NZ)-N-[(3R)-5-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxy-diphenylmethyl]pyrrolidin-1-ium-1-ylidene]-1,3-diphenylpentylidene]carbamate (PubChem CID 154707642) has the molecular formula C45H57N2O3Si+ and a molecular weight of 702.05 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(3R)-5-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxy-diphenylmethyl]pyrrolidin-1-ium-1-ylidene]-1,3-diphenylpentylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(3R)-5-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxy-diphenylmethyl]pyrrolidin-1-ium-1-ylidene]-1,3-diphenylpentylidene]carbamate |
|---|---|
| PubChem CID | 154707642 |
| Molecular Formula | C45H57N2O3Si+ |
| Molecular Weight | 702.05 g/mol |
| Exact Mass | 701.41 |
| IUPAC Name | tert-butyl (NZ)-N-[(3R)-5-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxy-diphenylmethyl]pyrrolidin-1-ium-1-ylidene]-1,3-diphenylpentylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(/C[C@@H](C/C=[N+]1\CCC[C@H]1C(O[Si](C)(C)C(C)(C)C)(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H57N2O3Si/c1-43(2,3)49-42(48)46-40(36-24-15-10-16-25-36)34-37(35-22-13-9-14-23-35)31-33-47-32-21-30-41(47)45(38-26-17-11-18-27-38,39-28-19-12-20-29-39)50-51(7,8)44(4,5)6/h9-20,22-29,33,37,41H,21,30-32,34H2,1-8H3/q+1/b46-40-,47-33+/t37-,41+/m1/s1 |
| InChIKey | RZPIKRSLGVCPET-JKSVXMLZSA-N |
| XLogP | 11.19 |
| TPSA | 50.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.05 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|