C22H38N2O2Si — CID 11326747
(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-1-imine (PubChem CID 11326747) has the molecular formula C22H38N2O2Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-1-imine.
| Compound Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-1-imine |
|---|---|
| PubChem CID | 11326747 |
| Molecular Formula | C22H38N2O2Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38N2O2Si/c1-22(2,3)27(5,6)26-21(15-14-19-11-8-7-9-12-19)17-23-24-16-10-13-20(24)18-25-4/h7-9,11-12,17,20-21H,10,13-16,18H2,1-6H3/b23-17+/t20-,21-/m0/s1 |
| InChIKey | WWYITHNZWGYXAT-FELYGFLISA-N |
| XLogP | 5.11 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|