C24H34N2O2Si — CID 11080105
(E)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethanimine (PubChem CID 11080105) has the molecular formula C24H34N2O2Si and a molecular weight of 410.63 g/mol. Its IUPAC name is (E)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethanimine.
| Compound Name | (E)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethanimine |
|---|---|
| PubChem CID | 11080105 |
| Molecular Formula | C24H34N2O2Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | (E)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethanimine |
| SMILES | COC[C@@H]1CCCN1/N=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34N2O2Si/c1-24(2,3)29(22-13-7-5-8-14-22,23-15-9-6-10-16-23)28-19-17-25-26-18-11-12-21(26)20-27-4/h5-10,13-17,21H,11-12,18-20H2,1-4H3/b25-17+/t21-/m0/s1 |
| InChIKey | DOAKQBKZZYQLBR-DIWDRYHZSA-N |
| XLogP | 3.66 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|