C23H31N2OP — CID 10883783
(E,2S)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentan-1-imine (PubChem CID 10883783) has the molecular formula C23H31N2OP and a molecular weight of 382.49 g/mol. Its IUPAC name is (E,2S)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentan-1-imine.
| Compound Name | (E,2S)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentan-1-imine |
|---|---|
| PubChem CID | 10883783 |
| Molecular Formula | C23H31N2OP |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (E,2S)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentan-1-imine |
| SMILES | CCC[C@@H](/C=N/N1CCC[C@H]1COC)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31N2OP/c1-3-11-23(18-24-25-17-10-12-20(25)19-26-2)27(21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-9,13-16,18,20,23H,3,10-12,17,19H2,1-2H3/b24-18+/t20-,23-/m0/s1 |
| InChIKey | BSLOHHFPPZVQQU-ORZORADFSA-N |
| XLogP | 4.38 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|