C27H31N2OP — CID 15259745
(Z,2R)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine (PubChem CID 15259745) has the molecular formula C27H31N2OP and a molecular weight of 430.53 g/mol. Its IUPAC name is (Z,2R)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine.
| Compound Name | (Z,2R)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 15259745 |
| Molecular Formula | C27H31N2OP |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (Z,2R)-2-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C(/c1ccccc1)[C@@H](C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N2OP/c1-22(31(25-16-8-4-9-17-25)26-18-10-5-11-19-26)27(23-13-6-3-7-14-23)28-29-20-12-15-24(29)21-30-2/h3-11,13-14,16-19,22,24H,12,15,20-21H2,1-2H3/b28-27+/t22-,24+/m1/s1 |
| InChIKey | HSJIOTOYDKZLDB-JDBSLOAXSA-N |
| XLogP | 5.02 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|