C24H33BN2OP — CID 10862478
CID 10862478 (PubChem CID 10862478) has the molecular formula C24H33BN2OP and a molecular weight of 407.33 g/mol.
| Compound Name | CID 10862478 |
|---|---|
| PubChem CID | 10862478 |
| Molecular Formula | C24H33BN2OP |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | — |
| SMILES | CCCC[C@H](/C=N\N1CCC[C@H]1COC)P(c1ccccc1)c1ccccc1.[B] |
| InChI | InChI=1S/C24H33N2OP.B/c1-3-4-13-24(19-25-26-18-11-12-21(26)20-27-2)28(22-14-7-5-8-15-22)23-16-9-6-10-17-23;/h5-10,14-17,19,21,24H,3-4,11-13,18,20H2,1-2H3;/b25-19-;/t21-,24+;/m0./s1 |
| InChIKey | IIHOXTBRXANHKP-SZRLNCRYSA-N |
| XLogP | 4.39 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|