C25H35N2OP — CID 10960854
(Z,3S)-3-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]heptan-4-imine (PubChem CID 10960854) has the molecular formula C25H35N2OP and a molecular weight of 410.54 g/mol. Its IUPAC name is (Z,3S)-3-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]heptan-4-imine.
| Compound Name | (Z,3S)-3-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]heptan-4-imine |
|---|---|
| PubChem CID | 10960854 |
| Molecular Formula | C25H35N2OP |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (Z,3S)-3-diphenylphosphanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]heptan-4-imine |
| SMILES | CCC/C(=N/N1CCC[C@H]1COC)[C@H](CC)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35N2OP/c1-4-13-24(26-27-19-12-14-21(27)20-28-3)25(5-2)29(22-15-8-6-9-16-22)23-17-10-7-11-18-23/h6-11,15-18,21,25H,4-5,12-14,19-20H2,1-3H3/b26-24-/t21-,25-/m0/s1 |
| InChIKey | PQXPSPRFKCGFHZ-FSAIWTQFSA-N |
| XLogP | 5.16 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|