C36H58N2O3Si2 — CID 11215736
(E,E)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylhex-4-en-1-imine (PubChem CID 11215736) has the molecular formula C36H58N2O3Si2 and a molecular weight of 623.04 g/mol. Its IUPAC name is (E,E)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylhex-4-en-1-imine.
| Compound Name | (E,E)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylhex-4-en-1-imine |
|---|---|
| PubChem CID | 11215736 |
| Molecular Formula | C36H58N2O3Si2 |
| Molecular Weight | 623.04 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | (E,E)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylhex-4-en-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/CC/C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)=C(/C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H58N2O3Si2/c1-30(27-40-42(9,10)35(2,3)4)31(19-17-25-37-38-26-18-20-32(38)29-39-8)28-41-43(36(5,6)7,33-21-13-11-14-22-33)34-23-15-12-16-24-34/h11-16,21-25,32H,17-20,26-29H2,1-10H3/b31-30+,37-25+/t32-/m0/s1 |
| InChIKey | XWJVECNIIJLOQF-DADUBACJSA-N |
| XLogP | 7.78 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.04 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|