C24H35N3O2Si — CID 177383564
(2S)-N-[(E)-2-[tert-butyl(diphenyl)silyl]oxyethylideneamino]-2-(methoxymethyl)pyrrolidin-1-amine (PubChem CID 177383564) has the molecular formula C24H35N3O2Si and a molecular weight of 425.65 g/mol. Its IUPAC name is (2S)-N-[(E)-2-[tert-butyl(diphenyl)silyl]oxyethylideneamino]-2-(methoxymethyl)pyrrolidin-1-amine.
| Compound Name | (2S)-N-[(E)-2-[tert-butyl(diphenyl)silyl]oxyethylideneamino]-2-(methoxymethyl)pyrrolidin-1-amine |
|---|---|
| PubChem CID | 177383564 |
| Molecular Formula | C24H35N3O2Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (2S)-N-[(E)-2-[tert-butyl(diphenyl)silyl]oxyethylideneamino]-2-(methoxymethyl)pyrrolidin-1-amine |
| SMILES | COC[C@@H]1CCCN1N/N=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H35N3O2Si/c1-24(2,3)30(22-13-7-5-8-14-22,23-15-9-6-10-16-23)29-19-17-25-26-27-18-11-12-21(27)20-28-4/h5-10,13-17,21,26H,11-12,18-20H2,1-4H3/b25-17+/t21-/m0/s1 |
| InChIKey | NYIQMBSBCXZLBP-DIWDRYHZSA-N |
| XLogP | 3.16 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|