C27H40N2O2Si — CID 11442372
(E,2R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylbutan-1-imine (PubChem CID 11442372) has the molecular formula C27H40N2O2Si and a molecular weight of 452.72 g/mol. Its IUPAC name is (E,2R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylbutan-1-imine.
| Compound Name | (E,2R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylbutan-1-imine |
|---|---|
| PubChem CID | 11442372 |
| Molecular Formula | C27H40N2O2Si |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (E,2R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylbutan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40N2O2Si/c1-23(21-28-29-19-12-13-24(29)22-30-5)18-20-31-32(27(2,3)4,25-14-8-6-9-15-25)26-16-10-7-11-17-26/h6-11,14-17,21,23-24H,12-13,18-20,22H2,1-5H3/b28-21+/t23-,24+/m1/s1 |
| InChIKey | LNJGTGRTVRURRW-HGUFJYQQSA-N |
| XLogP | 4.69 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|