C28H42N2O2Si — CID 23649795
(E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methylpentan-1-imine (PubChem CID 23649795) has the molecular formula C28H42N2O2Si and a molecular weight of 466.74 g/mol. Its IUPAC name is (E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methylpentan-1-imine.
| Compound Name | (E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methylpentan-1-imine |
|---|---|
| PubChem CID | 23649795 |
| Molecular Formula | C28H42N2O2Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | (E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methylpentan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/CC[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42N2O2Si/c1-24(14-12-20-29-30-21-13-15-25(30)23-31-5)22-32-33(28(2,3)4,26-16-8-6-9-17-26)27-18-10-7-11-19-27/h6-11,16-20,24-25H,12-15,21-23H2,1-5H3/b29-20+/t24-,25+/m1/s1 |
| InChIKey | HKYXZVWQAMALIN-NNWZRIAHSA-N |
| XLogP | 5.08 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|