C25H35N3O — CID 15781130
(1E,2S)-N,N-dibenzyl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-amine (PubChem CID 15781130) has the molecular formula C25H35N3O and a molecular weight of 393.57 g/mol. Its IUPAC name is (1E,2S)-N,N-dibenzyl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-amine.
| Compound Name | (1E,2S)-N,N-dibenzyl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 15781130 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | (1E,2S)-N,N-dibenzyl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-amine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](C(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35N3O/c1-21(2)25(17-26-28-16-10-15-24(28)20-29-3)27(18-22-11-6-4-7-12-22)19-23-13-8-5-9-14-23/h4-9,11-14,17,21,24-25H,10,15-16,18-20H2,1-3H3/b26-17+/t24-,25+/m0/s1 |
| InChIKey | CJHXTBOLTUVDSV-TZPSQSCCSA-N |
| XLogP | 4.81 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|