C29H44N2O2Si — CID 23649831
(E,2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylpentan-1-imine (PubChem CID 23649831) has the molecular formula C29H44N2O2Si and a molecular weight of 480.77 g/mol. Its IUPAC name is (E,2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylpentan-1-imine.
| Compound Name | (E,2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylpentan-1-imine |
|---|---|
| PubChem CID | 23649831 |
| Molecular Formula | C29H44N2O2Si |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (E,2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylpentan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H44N2O2Si/c1-24(21-30-31-19-13-14-26(31)23-32-6)20-25(2)22-33-34(29(3,4)5,27-15-9-7-10-16-27)28-17-11-8-12-18-28/h7-12,15-18,21,24-26H,13-14,19-20,22-23H2,1-6H3/b30-21+/t24-,25+,26-/m0/s1 |
| InChIKey | ICGOSRXLFSACOG-PERLGIJMSA-N |
| XLogP | 5.32 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|