C29H32Cl2O6 — CID 10973627
(2R,3R,4R,5R,6S)-3-(dichloromethyl)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-ol (PubChem CID 10973627) has the molecular formula C29H32Cl2O6 and a molecular weight of 547.48 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-3-(dichloromethyl)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6S)-3-(dichloromethyl)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 10973627 |
| Molecular Formula | C29H32Cl2O6 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | (2R,3R,4R,5R,6S)-3-(dichloromethyl)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-ol |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@](O)(C(Cl)Cl)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C29H32Cl2O6/c1-33-24-25(34-2)28(32,27(30)31)23(37-26(24)35-3)19-36-29(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23-27,32H,19H2,1-3H3/t23-,24-,25-,26+,28-/m1/s1 |
| InChIKey | AYSSYMGVHTYZNI-FCSZGESBSA-N |
| XLogP | 4.93 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|