C30H29NO11 — CID 10973898
[(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(15,17-dioxo-16-azatetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-yl)oxan-2-yl]methyl acetate (PubChem CID 10973898) has the molecular formula C30H29NO11 and a molecular weight of 579.56 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(15,17-dioxo-16-azatetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(15,17-dioxo-16-azatetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10973898 |
| Molecular Formula | C30H29NO11 |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(15,17-dioxo-16-azatetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](N2C(=O)C3c4ccccc4C(C2=O)c2ccccc23)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H29NO11/c1-14(32)38-13-22-26(39-15(2)33)27(40-16(3)34)25(30(42-22)41-17(4)35)31-28(36)23-18-9-5-6-10-19(18)24(29(31)37)21-12-8-7-11-20(21)23/h5-12,22-27,30H,13H2,1-4H3/t22-,23?,24?,25-,26-,27-,30+/m1/s1 |
| InChIKey | RXEPBYKJDFTFCR-KTIYBKSUSA-N |
| XLogP | 1.72 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|