C15H17NO3 — CID 10978168
ethyl 2,6,8-trimethyl-1-oxoisoquinoline-7-carboxylate (PubChem CID 10978168) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 2,6,8-trimethyl-1-oxoisoquinoline-7-carboxylate.
| Compound Name | ethyl 2,6,8-trimethyl-1-oxoisoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 10978168 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl 2,6,8-trimethyl-1-oxoisoquinoline-7-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2ccn(C)c(=O)c2c1C |
| InChI | InChI=1S/C15H17NO3/c1-5-19-15(18)12-9(2)8-11-6-7-16(4)14(17)13(11)10(12)3/h6-8H,5H2,1-4H3 |
| InChIKey | QDKHZJLDGNNMCZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |