C15H18F2O2 — CID 10978456
(3,3-difluoro-2-prop-2-enoxypent-4-enoxy)methylbenzene (PubChem CID 10978456) has the molecular formula C15H18F2O2 and a molecular weight of 268.30 g/mol. Its IUPAC name is (3,3-difluoro-2-prop-2-enoxypent-4-enoxy)methylbenzene.
| Compound Name | (3,3-difluoro-2-prop-2-enoxypent-4-enoxy)methylbenzene |
|---|---|
| PubChem CID | 10978456 |
| Molecular Formula | C15H18F2O2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (3,3-difluoro-2-prop-2-enoxypent-4-enoxy)methylbenzene |
| SMILES | C=CCOC(COCc1ccccc1)C(F)(F)C=C |
| InChI | InChI=1S/C15H18F2O2/c1-3-10-19-14(15(16,17)4-2)12-18-11-13-8-6-5-7-9-13/h3-9,14H,1-2,10-12H2 |
| InChIKey | GJDXNNVMCGGVIW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|