C14H15NO4S — CID 10979250
4-methylbenzenesulfonate;1-methylpyridin-1-ium-4-carbaldehyde (PubChem CID 10979250) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;1-methylpyridin-1-ium-4-carbaldehyde.
| Compound Name | 4-methylbenzenesulfonate;1-methylpyridin-1-ium-4-carbaldehyde |
|---|---|
| PubChem CID | 10979250 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-methylbenzenesulfonate;1-methylpyridin-1-ium-4-carbaldehyde |
| SMILES | C[n+]1ccc(C=O)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8NO.C7H8O3S/c1-8-4-2-7(6-9)3-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h2-6H,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | DRNGPPYFUCOXLW-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|