C12H18O5S2 — CID 10979699
[(4aR,6S,7S,8R,8aS)-8-acetyloxy-6-methyl-3,4a,6,7,8,8a-hexahydro-2H-[1,4]dithiino[2,3-b]pyran-7-yl] acetate (PubChem CID 10979699) has the molecular formula C12H18O5S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is [(4aR,6S,7S,8R,8aS)-8-acetyloxy-6-methyl-3,4a,6,7,8,8a-hexahydro-2H-[1,4]dithiino[2,3-b]pyran-7-yl] acetate.
| Compound Name | [(4aR,6S,7S,8R,8aS)-8-acetyloxy-6-methyl-3,4a,6,7,8,8a-hexahydro-2H-[1,4]dithiino[2,3-b]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 10979699 |
| Molecular Formula | C12H18O5S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | [(4aR,6S,7S,8R,8aS)-8-acetyloxy-6-methyl-3,4a,6,7,8,8a-hexahydro-2H-[1,4]dithiino[2,3-b]pyran-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](C)O[C@@H]2SCCS[C@@H]12 |
| InChI | InChI=1S/C12H18O5S2/c1-6-9(16-7(2)13)10(17-8(3)14)11-12(15-6)19-5-4-18-11/h6,9-12H,4-5H2,1-3H3/t6-,9-,10+,11-,12+/m0/s1 |
| InChIKey | OCIJVPSYXWTQKR-JYKCKQTKSA-N |
| XLogP | 1.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |