C8H5Br2F2N — CID 10979905
5,7-dibromo-3,3-difluoro-1,2-dihydroindole (PubChem CID 10979905) has the molecular formula C8H5Br2F2N and a molecular weight of 312.94 g/mol. Its IUPAC name is 5,7-dibromo-3,3-difluoro-1,2-dihydroindole.
| Compound Name | 5,7-dibromo-3,3-difluoro-1,2-dihydroindole |
|---|---|
| PubChem CID | 10979905 |
| Molecular Formula | C8H5Br2F2N |
| Molecular Weight | 312.94 g/mol |
| Exact Mass | 310.88 |
| IUPAC Name | 5,7-dibromo-3,3-difluoro-1,2-dihydroindole |
| SMILES | FC1(F)CNc2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C8H5Br2F2N/c9-4-1-5-7(6(10)2-4)13-3-8(5,11)12/h1-2,13H,3H2 |
| InChIKey | GFXMPKJQPQNTGX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |