C12H15BrFN — CID 106701962
7-bromo-3,3-diethyl-5-fluoro-1,2-dihydroindole (PubChem CID 106701962) has the molecular formula C12H15BrFN and a molecular weight of 272.16 g/mol. Its IUPAC name is 7-bromo-3,3-diethyl-5-fluoro-1,2-dihydroindole.
| Compound Name | 7-bromo-3,3-diethyl-5-fluoro-1,2-dihydroindole |
|---|---|
| PubChem CID | 106701962 |
| Molecular Formula | C12H15BrFN |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 7-bromo-3,3-diethyl-5-fluoro-1,2-dihydroindole |
| SMILES | CCC1(CC)CNc2c(Br)cc(F)cc21 |
| InChI | InChI=1S/C12H15BrFN/c1-3-12(4-2)7-15-11-9(12)5-8(14)6-10(11)13/h5-6,15H,3-4,7H2,1-2H3 |
| InChIKey | GLYJQQQVTWJBGP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |