C13H18F2N2 — CID 115510199
3,3-diethyl-6,8-difluoro-1,2,4,5-tetrahydro-1,5-benzodiazepine (PubChem CID 115510199) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3,3-diethyl-6,8-difluoro-1,2,4,5-tetrahydro-1,5-benzodiazepine.
| Compound Name | 3,3-diethyl-6,8-difluoro-1,2,4,5-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 115510199 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3,3-diethyl-6,8-difluoro-1,2,4,5-tetrahydro-1,5-benzodiazepine |
| SMILES | CCC1(CC)CNc2cc(F)cc(F)c2NC1 |
| InChI | InChI=1S/C13H18F2N2/c1-3-13(4-2)7-16-11-6-9(14)5-10(15)12(11)17-8-13/h5-6,16-17H,3-4,7-8H2,1-2H3 |
| InChIKey | VQABMDQCOQAFLE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |