C12H14F2N2 — CID 115510189
6,8-difluorospiro[1,3,4,5-tetrahydro-1,5-benzodiazepine-2,1'-cyclobutane] (PubChem CID 115510189) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is 6,8-difluorospiro[1,3,4,5-tetrahydro-1,5-benzodiazepine-2,1'-cyclobutane].
| Compound Name | 6,8-difluorospiro[1,3,4,5-tetrahydro-1,5-benzodiazepine-2,1'-cyclobutane] |
|---|---|
| PubChem CID | 115510189 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 6,8-difluorospiro[1,3,4,5-tetrahydro-1,5-benzodiazepine-2,1'-cyclobutane] |
| SMILES | Fc1cc(F)c2c(c1)NC1(CCC1)CCN2 |
| InChI | InChI=1S/C12H14F2N2/c13-8-6-9(14)11-10(7-8)16-12(2-1-3-12)4-5-15-11/h6-7,15-16H,1-5H2 |
| InChIKey | ZLNFNVLBOMJXBP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |