C11H14F2N2 — CID 84621650
6,8-difluoro-3,3,4-trimethyl-1,2-dihydroquinoxaline (PubChem CID 84621650) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 6,8-difluoro-3,3,4-trimethyl-1,2-dihydroquinoxaline.
| Compound Name | 6,8-difluoro-3,3,4-trimethyl-1,2-dihydroquinoxaline |
|---|---|
| PubChem CID | 84621650 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 6,8-difluoro-3,3,4-trimethyl-1,2-dihydroquinoxaline |
| SMILES | CN1c2cc(F)cc(F)c2NCC1(C)C |
| InChI | InChI=1S/C11H14F2N2/c1-11(2)6-14-10-8(13)4-7(12)5-9(10)15(11)3/h4-5,14H,6H2,1-3H3 |
| InChIKey | URHARWVYVDRSBI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |