C13H17F3N2 — CID 64948984
3,3-dimethyl-1-(2,3,5-trifluorophenyl)-1,4-diazepane (PubChem CID 64948984) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2,3,5-trifluorophenyl)-1,4-diazepane.
| Compound Name | 3,3-dimethyl-1-(2,3,5-trifluorophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64948984 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3,3-dimethyl-1-(2,3,5-trifluorophenyl)-1,4-diazepane |
| SMILES | CC1(C)CN(c2cc(F)cc(F)c2F)CCCN1 |
| InChI | InChI=1S/C13H17F3N2/c1-13(2)8-18(5-3-4-17-13)11-7-9(14)6-10(15)12(11)16/h6-7,17H,3-5,8H2,1-2H3 |
| InChIKey | WVGDMTOHBWBCEO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|