C11H13F2N — CID 106701849
3-ethyl-5,7-difluoro-3-methyl-1,2-dihydroindole (PubChem CID 106701849) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-ethyl-5,7-difluoro-3-methyl-1,2-dihydroindole.
| Compound Name | 3-ethyl-5,7-difluoro-3-methyl-1,2-dihydroindole |
|---|---|
| PubChem CID | 106701849 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-ethyl-5,7-difluoro-3-methyl-1,2-dihydroindole |
| SMILES | CCC1(C)CNc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C11H13F2N/c1-3-11(2)6-14-10-8(11)4-7(12)5-9(10)13/h4-5,14H,3,6H2,1-2H3 |
| InChIKey | LLAKKDAXXXTTLW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |