C11H16N2 — CID 125453278
(3R)-3-ethyl-3-methyl-1,2-dihydroindol-5-amine (PubChem CID 125453278) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (3R)-3-ethyl-3-methyl-1,2-dihydroindol-5-amine.
| Compound Name | (3R)-3-ethyl-3-methyl-1,2-dihydroindol-5-amine |
|---|---|
| PubChem CID | 125453278 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (3R)-3-ethyl-3-methyl-1,2-dihydroindol-5-amine |
| SMILES | CC[C@@]1(C)CNc2ccc(N)cc21 |
| InChI | InChI=1S/C11H16N2/c1-3-11(2)7-13-10-5-4-8(12)6-9(10)11/h4-6,13H,3,7,12H2,1-2H3/t11-/m0/s1 |
| InChIKey | TUFRDTVYEDOLCL-NSHDSACASA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|