C10H14N2O — CID 84618446
3,3-dimethyl-2,4-dihydro-1,4-benzoxazin-7-amine (PubChem CID 84618446) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 3,3-dimethyl-2,4-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 84618446 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydro-1,4-benzoxazin-7-amine |
| SMILES | CC1(C)COc2cc(N)ccc2N1 |
| InChI | InChI=1S/C10H14N2O/c1-10(2)6-13-9-5-7(11)3-4-8(9)12-10/h3-5,12H,6,11H2,1-2H3 |
| InChIKey | KSYKOVLPSLLYKI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|