C10H10F2N2O — CID 84621637
3-ethyl-5,7-difluoro-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 84621637) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is 3-ethyl-5,7-difluoro-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 3-ethyl-5,7-difluoro-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 84621637 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-ethyl-5,7-difluoro-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CCC1Nc2c(F)cc(F)cc2NC1=O |
| InChI | InChI=1S/C10H10F2N2O/c1-2-7-10(15)14-8-4-5(11)3-6(12)9(8)13-7/h3-4,7,13H,2H2,1H3,(H,14,15) |
| InChIKey | GVAVARAGQMOALU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |