C13H11F2NO — CID 106987276
5,7-difluoro-3-pent-3-ynyl-1,3-dihydroindol-2-one (PubChem CID 106987276) has the molecular formula C13H11F2NO and a molecular weight of 235.23 g/mol. Its IUPAC name is 5,7-difluoro-3-pent-3-ynyl-1,3-dihydroindol-2-one.
| Compound Name | 5,7-difluoro-3-pent-3-ynyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106987276 |
| Molecular Formula | C13H11F2NO |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5,7-difluoro-3-pent-3-ynyl-1,3-dihydroindol-2-one |
| SMILES | CC#CCCC1C(=O)Nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C13H11F2NO/c1-2-3-4-5-9-10-6-8(14)7-11(15)12(10)16-13(9)17/h6-7,9H,4-5H2,1H3,(H,16,17) |
| InChIKey | BANQDVUMCUURDK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|