C16H19F2NO — CID 106986942
3-(4,4-dimethylcyclohexyl)-5,7-difluoro-1,3-dihydroindol-2-one (PubChem CID 106986942) has the molecular formula C16H19F2NO and a molecular weight of 279.33 g/mol. Its IUPAC name is 3-(4,4-dimethylcyclohexyl)-5,7-difluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-(4,4-dimethylcyclohexyl)-5,7-difluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106986942 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-(4,4-dimethylcyclohexyl)-5,7-difluoro-1,3-dihydroindol-2-one |
| SMILES | CC1(C)CCC(C2C(=O)Nc3c(F)cc(F)cc32)CC1 |
| InChI | InChI=1S/C16H19F2NO/c1-16(2)5-3-9(4-6-16)13-11-7-10(17)8-12(18)14(11)19-15(13)20/h7-9,13H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | UMHXVVVGICMFDA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |