C11H9F2N3O — CID 114990300
3-[(5,7-difluoro-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile (PubChem CID 114990300) has the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. Its IUPAC name is 3-[(5,7-difluoro-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile.
| Compound Name | 3-[(5,7-difluoro-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 114990300 |
| Molecular Formula | C11H9F2N3O |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-[(5,7-difluoro-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile |
| SMILES | N#CCCNC1C(=O)Nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C11H9F2N3O/c12-6-4-7-9(8(13)5-6)16-11(17)10(7)15-3-1-2-14/h4-5,10,15H,1,3H2,(H,16,17) |
| InChIKey | VJSLZWWQDOXUIW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|