C12H12FN3O — CID 114993646
3-[(7-fluoro-5-methyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile (PubChem CID 114993646) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 3-[(7-fluoro-5-methyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile.
| Compound Name | 3-[(7-fluoro-5-methyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 114993646 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-[(7-fluoro-5-methyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanenitrile |
| SMILES | Cc1cc(F)c2c(c1)C(NCCC#N)C(=O)N2 |
| InChI | InChI=1S/C12H12FN3O/c1-7-5-8-10(9(13)6-7)16-12(17)11(8)15-4-2-3-14/h5-6,11,15H,2,4H2,1H3,(H,16,17) |
| InChIKey | VXGKSRBDMVKYBZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|